3,6,9,12,15,18,21,24,27,30-Decaoxadotriacontane-1,32-diamine, 97%
cas: 928292-69-7 — see every product listed under this CAS number, including other names
3,6,9,12,15,18,21,24,27,30-Decaoxadotriacontane-1,32-diamine, 97% (CAS 928292-69-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F869775-50MG |
| cas | 928292-69-7 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 294.71 Pln | |
| Fluorochem | 100mg | 341.56 Pln | |
| Fluorochem | 250mg | 471.73 Pln | |
| Fluorochem | 500mg | 737.26 Pln | |
| Fluorochem | 1g | 1106.92 Pln | |
| Fluorochem | 5g | 3475.88 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine (CAS 928292-69-7) is a chemical compound with the molecular formula C22H48N2O10 and a molecular weight of 500.6 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine. InChIKey: YMQALIUBVKNYIJ-UHFFFAOYSA-N.
| Molecular formula | C22H48N2O10 |
|---|---|
| Molecular weight | 500.6 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | YMQALIUBVKNYIJ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN)N |
Computed by PubChem (NCBI)