cas: 928292-69-7 — see every product listed under this CAS number, including other names
Amino-PEG10-amine 95% (CAS 928292-69-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A181623-50mg |
| cas | 928292-69-7 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 309.19 Pln | |
| Ambeed | 100mg | 364.81 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1171.38 Pln | |
| Ambeed | 5g | 3919.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A181623 |
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine (CAS 928292-69-7) is a chemical compound with the molecular formula C22H48N2O10 and a molecular weight of 500.6 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine. InChIKey: YMQALIUBVKNYIJ-UHFFFAOYSA-N.
| Molecular formula | C22H48N2O10 |
|---|---|
| Molecular weight | 500.6 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | YMQALIUBVKNYIJ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN)N |
Computed by PubChem (NCBI)