Amino-PEG10-amine, 97.0%
cas: 928292-69-7 — see every product listed under this CAS number, including other names
Amino-PEG10-amine, 97.0% (CAS 928292-69-7) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 250 mg, 500 mg, 50 mg, 100 mg, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W040270-1 g |
| cas | 928292-69-7 |
| size | 1 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 1341.37 Pln | |
| MedChemExpress | 250 mg | 575.11 Pln | |
| MedChemExpress | 500 mg | 909.48 Pln | |
| MedChemExpress | 50 mg | 384.71 Pln | |
| MedChemExpress | 100 mg | 454.37 Pln | |
| MedChemExpress | 5 g | 4364.62 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.0% |
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine (CAS 928292-69-7) is a chemical compound with the molecular formula C22H48N2O10 and a molecular weight of 500.6 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine. InChIKey: YMQALIUBVKNYIJ-UHFFFAOYSA-N.
| Molecular formula | C22H48N2O10 |
|---|---|
| Molecular weight | 500.6 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | YMQALIUBVKNYIJ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN)N |
Computed by PubChem (NCBI)