cas: 875770-32-4 — see every product listed under this CAS number, including other names
3,6,9,12-Tetraoxapentadec-14-yn-1-yl 4-methylbenzenesulfonate, 95% (CAS 875770-32-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F867789-250MG |
| cas | 875770-32-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 500mg | 253.05 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 1205.84 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 875770-32-4) is a chemical compound with the molecular formula C18H26O7S and a molecular weight of 386.5 g/mol. IUPAC name: 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: VUJIUZITHCTEAF-UHFFFAOYSA-N.
| Molecular formula | C18H26O7S |
|---|---|
| Molecular weight | 386.5 g/mol |
| IUPAC name | 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | VUJIUZITHCTEAF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCC#C |
Computed by PubChem (NCBI)