cas: 875770-32-4 — see every product listed under this CAS number, including other names
Propargyl-PEG4-Tos 98% (CAS 875770-32-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1221415-100mg |
| cas | 875770-32-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 1271.50 Pln | |
| Ambeed | 25g | 3668.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1221415 |
2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 875770-32-4) is a chemical compound with the molecular formula C18H26O7S and a molecular weight of 386.5 g/mol. IUPAC name: 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: VUJIUZITHCTEAF-UHFFFAOYSA-N.
| Molecular formula | C18H26O7S |
|---|---|
| Molecular weight | 386.5 g/mol |
| IUPAC name | 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | VUJIUZITHCTEAF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCC#C |
Computed by PubChem (NCBI)