cas: 875770-32-4 — see every product listed under this CAS number, including other names
Propargyl-PEG4-Tos, 98%, 98% (CAS 875770-32-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120E2R-100mg |
| cas | 875770-32-4 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 500mg | 246.80 Pln | |
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 1211.60 Pln | |
| Chemat | 25g | 3515.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 875770-32-4) is a chemical compound with the molecular formula C18H26O7S and a molecular weight of 386.5 g/mol. IUPAC name: 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: VUJIUZITHCTEAF-UHFFFAOYSA-N.
| Molecular formula | C18H26O7S |
|---|---|
| Molecular weight | 386.5 g/mol |
| IUPAC name | 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | VUJIUZITHCTEAF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCC#C |
Computed by PubChem (NCBI)