cas: 875770-32-4 — see every product listed under this CAS number, including other names
Propargyl-PEG4-Tos, 99.25% (CAS 875770-32-4) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 1 g, 500 mg, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-130387-5 g |
| cas | 875770-32-4 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 1434.25 Pln | |
| MedChemExpress | 1 g | 384.71 Pln | |
| MedChemExpress | 500 mg | 310.40 Pln | |
| MedChemExpress | 250 mg | 250.03 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.25% |
2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 875770-32-4) is a chemical compound with the molecular formula C18H26O7S and a molecular weight of 386.5 g/mol. IUPAC name: 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: VUJIUZITHCTEAF-UHFFFAOYSA-N.
| Molecular formula | C18H26O7S |
|---|---|
| Molecular weight | 386.5 g/mol |
| IUPAC name | 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | VUJIUZITHCTEAF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCC#C |
Computed by PubChem (NCBI)