3,6-Dibromo-9H-carbazole, 98%
cas: 6825-20-3 — see every product listed under this CAS number, including other names
3,6-Dibromo-9H-carbazole, 98% (CAS 6825-20-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg, 50g, 250g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F079479-5G |
| cas | 6825-20-3 |
| size | 5g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 96.86 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 25g | 112.48 Pln | |
| Fluorochem | 100g | 190.58 Pln | |
| Fluorochem | 500g | 685.19 Pln | |
| Fluorochem | 1kg | 1263.11 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 50g | 107.60 Pln | |
| Chemat | 100g | 146.00 Pln | |
| Chemat | 250g | 266.00 Pln | |
| Chemat | 500g | 532.80 Pln | |
| Chemat | 1kg | 938.00 Pln | |
| Chemat | 5kg | 4156.80 Pln | |
| Chemat | 10kg | price on request |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
3,6-dibromo-9H-carbazole (CAS 6825-20-3) is a chemical compound with the molecular formula C12H7Br2N and a molecular weight of 325.00 g/mol. IUPAC name: 3,6-dibromo-9H-carbazole. InChIKey: FIHILUSWISKVSR-UHFFFAOYSA-N.
| Molecular formula | C12H7Br2N |
|---|---|
| Molecular weight | 325.00 g/mol |
| IUPAC name | 3,6-dibromo-9H-carbazole |
| InChIKey | FIHILUSWISKVSR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C3=C(N2)C=CC(=C3)Br |
Computed by PubChem (NCBI)