3,7-Dichloro-1H-pyrazolo[4,3-d]pyrimidine, 95%
cas: 2091692-97-4 — see every product listed under this CAS number, including other names
3,7-Dichloro-1H-pyrazolo[4,3-d]pyrimidine, 95% (CAS 2091692-97-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F960384-100MG |
| cas | 2091692-97-4 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1205.84 Pln | |
| Fluorochem | 250mg | 2137.81 Pln | |
| Fluorochem | 1g | 6198.88 Pln | |
| Ambeed | 100mg | 993.38 Pln | |
| Ambeed | 250mg | 1627.50 Pln | |
| Ambeed | 1g | 4258.56 Pln | |
| BLDpharm | 100mg | 1064.09 Pln | |
| BLDpharm | 250mg | 1747.19 Pln | |
| BLDpharm | 1g | 4590.63 Pln | |
| Chemat | 100mg | 832.40 Pln | |
| Chemat | 250mg | 1480.40 Pln | |
| Chemat | 1g | 4317.20 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
3,7-dichloro-2H-pyrazolo[4,3-d]pyrimidine (CAS 2091692-97-4) is a chemical compound with the molecular formula C5H2Cl2N4 and a molecular weight of 189.00 g/mol. IUPAC name: 3,7-dichloro-2H-pyrazolo[4,3-d]pyrimidine. InChIKey: OUODFHBTWYVQTG-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N4 |
|---|---|
| Molecular weight | 189.00 g/mol |
| IUPAC name | 3,7-dichloro-2H-pyrazolo[4,3-d]pyrimidine |
| InChIKey | OUODFHBTWYVQTG-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(NN=C2C(=N1)Cl)Cl |
Computed by PubChem (NCBI)