Products 2091692-97-4
CAS 2091692-97-4 is the registry number for 3,7-Dichloro-1H-pyrazolo[4,3-d]pyrimidine, 95%. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,7-dichloro-2H-pyrazolo[4,3-d]pyrimidine (CAS 2091692-97-4) is a chemical compound with the molecular formula C5H2Cl2N4 and a molecular weight of 189.00 g/mol. IUPAC name: 3,7-dichloro-2H-pyrazolo[4,3-d]pyrimidine. InChIKey: OUODFHBTWYVQTG-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N4 |
|---|---|
| Molecular weight | 189.00 g/mol |
| IUPAC name | 3,7-dichloro-2H-pyrazolo[4,3-d]pyrimidine |
| InChIKey | OUODFHBTWYVQTG-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(NN=C2C(=N1)Cl)Cl |
Computed by PubChem (NCBI)