3,8-Dimethyl-1,10-phenanthroline, 97%
cas: 3002-80-0 — see every product listed under this CAS number, including other names
3,8-Dimethyl-1,10-phenanthroline, 97% (CAS 3002-80-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A983766-50mg |
| cas | 3002-80-0 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 531.69 Pln | |
| Ambeed | 100mg | 832.06 Pln | |
| Ambeed | 250mg | 1610.81 Pln | |
| Ambeed | 1g | 3941.50 Pln | |
| Chemat | 50mg | 525.20 Pln | |
| Chemat | 100mg | 616.40 Pln | |
| Chemat | 250mg | 1096.40 Pln | |
| Chemat | 1g | 2128.40 Pln | |
| BLDpharm | 50mg | 564.27 Pln | |
| BLDpharm | 100mg | 891.93 Pln | |
| BLDpharm | 250mg | 1730.53 Pln | |
| BLDpharm | 1g | 4246.31 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
3,8-dimethyl-1,10-phenanthroline (CAS 3002-80-0) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 3,8-dimethyl-1,10-phenanthroline. InChIKey: KSACKJIWQPGKMJ-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 3,8-dimethyl-1,10-phenanthroline |
| InChIKey | KSACKJIWQPGKMJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3=C(C=C2)C=C(C=N3)C)N=C1 |
Computed by PubChem (NCBI)