cas: 263349-24-2 — see every product listed under this CAS number, including other names
3–Bromo–4–morpholinobenzaldehyde (CAS 263349-24-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF31325-100mg |
| cas | 263349-24-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 578.32 Pln | |
| GLPBio | 1g | 924.67 Pln | |
| GLPBio | 250mg | 671.93 Pln | |
| GLPBio | 5g | 1996.51 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
3-bromo-4-morpholin-4-ylbenzaldehyde (CAS 263349-24-2) is a chemical compound with the molecular formula C11H12BrNO2 and a molecular weight of 270.12 g/mol. IUPAC name: 3-bromo-4-morpholin-4-ylbenzaldehyde. InChIKey: ARPSCKOKVZPRIN-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO2 |
|---|---|
| Molecular weight | 270.12 g/mol |
| IUPAC name | 3-bromo-4-morpholin-4-ylbenzaldehyde |
| InChIKey | ARPSCKOKVZPRIN-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)C=O)Br |
Computed by PubChem (NCBI)