cas: 263349-24-2 — see every product listed under this CAS number, including other names
3-Bromo-4-morpholinobenzaldehyde, 98%, 98% (CAS 263349-24-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113SSS-100mg |
| cas | 263349-24-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 208.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-bromo-4-morpholin-4-ylbenzaldehyde (CAS 263349-24-2) is a chemical compound with the molecular formula C11H12BrNO2 and a molecular weight of 270.12 g/mol. IUPAC name: 3-bromo-4-morpholin-4-ylbenzaldehyde. InChIKey: ARPSCKOKVZPRIN-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO2 |
|---|---|
| Molecular weight | 270.12 g/mol |
| IUPAC name | 3-bromo-4-morpholin-4-ylbenzaldehyde |
| InChIKey | ARPSCKOKVZPRIN-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)C=O)Br |
Computed by PubChem (NCBI)