cas: 1160259-92-6 — see every product listed under this CAS number, including other names
3-((3,4-Dichlorobenzyl)oxy)benzoyl chloride, 97% (CAS 1160259-92-6) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A158239-5g |
| cas | 1160259-92-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8533.00 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-[(3,4-dichlorophenyl)methoxy]benzoyl chloride (CAS 1160259-92-6) is a chemical compound with the molecular formula C14H9Cl3O2 and a molecular weight of 315.6 g/mol. IUPAC name: 3-[(3,4-dichlorophenyl)methoxy]benzoyl chloride. InChIKey: CPLMHKOJMQLVOM-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl3O2 |
|---|---|
| Molecular weight | 315.6 g/mol |
| IUPAC name | 3-[(3,4-dichlorophenyl)methoxy]benzoyl chloride |
| InChIKey | CPLMHKOJMQLVOM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC2=CC(=C(C=C2)Cl)Cl)C(=O)Cl |
Computed by PubChem (NCBI)