CAS 1820648-38-1 is the registry number for methyl 3-chloro-5-(3,4-dichlorophenyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3-chloro-5-(3,4-dichlorophenyl)benzoate (CAS 1820648-38-1) is a chemical compound with the molecular formula C14H9Cl3O2 and a molecular weight of 315.6 g/mol. IUPAC name: methyl 3-chloro-5-(3,4-dichlorophenyl)benzoate. InChIKey: OFRVGYYLNIKEHX-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl3O2 |
|---|---|
| Molecular weight | 315.6 g/mol |
| IUPAC name | methyl 3-chloro-5-(3,4-dichlorophenyl)benzoate |
| InChIKey | OFRVGYYLNIKEHX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C2=CC(=C(C=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)