Products 1160260-54-7
CAS 1160260-54-7 appears in our catalog under these names: 4-[(2,4-Dichlorobenzyl)oxy]benzoyl chloride, 95%, 4-((2,4-Dichlorobenzyl)oxy)benzoyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-[(2,4-dichlorophenyl)methoxy]benzoyl chloride (CAS 1160260-54-7) is a chemical compound with the molecular formula C14H9Cl3O2 and a molecular weight of 315.6 g/mol. IUPAC name: 4-[(2,4-dichlorophenyl)methoxy]benzoyl chloride. InChIKey: AHNBJIPQTHTYDP-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl3O2 |
|---|---|
| Molecular weight | 315.6 g/mol |
| IUPAC name | 4-[(2,4-dichlorophenyl)methoxy]benzoyl chloride |
| InChIKey | AHNBJIPQTHTYDP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)Cl)OCC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)