CAS 590376-27-5 appears in our catalog under these names: 5-Chloro-2-[(2,6-dichlorobenzyl)oxy]benzaldehyde, 95%, 5-Chloro-2-((2,6-dichlorobenzyl)oxy)benzaldehyde, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-chloro-2-[(2,6-dichlorophenyl)methoxy]benzaldehyde (CAS 590376-27-5) is a chemical compound with the molecular formula C14H9Cl3O2 and a molecular weight of 315.6 g/mol. IUPAC name: 5-chloro-2-[(2,6-dichlorophenyl)methoxy]benzaldehyde. InChIKey: YARFMPRSMRRMIV-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl3O2 |
|---|---|
| Molecular weight | 315.6 g/mol |
| IUPAC name | 5-chloro-2-[(2,6-dichlorophenyl)methoxy]benzaldehyde |
| InChIKey | YARFMPRSMRRMIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)COC2=C(C=C(C=C2)Cl)C=O)Cl |
Computed by PubChem (NCBI)