cas: 60169-56-4 — see every product listed under this CAS number, including other names
3-((3,4-Dimethoxyphenyl)sulfanyl)propanoic acid, 95% (CAS 60169-56-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1136041-10g |
| cas | 60169-56-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 17842.30 Pln | |
| AmBeed | 5g | 11495.05 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(3,4-dimethoxyphenyl)sulfanylpropanoic acid (CAS 60169-56-4) is a chemical compound with the molecular formula C11H14O4S and a molecular weight of 242.29 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)sulfanylpropanoic acid. InChIKey: HVWIZKGQLSYPCB-UHFFFAOYSA-N.
| Molecular formula | C11H14O4S |
|---|---|
| Molecular weight | 242.29 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)sulfanylpropanoic acid |
| InChIKey | HVWIZKGQLSYPCB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)SCCC(=O)O)OC |
Computed by PubChem (NCBI)