CAS 100059-51-6 appears in our catalog under these names: 4-(Butane-1-sulfonyl)benzoic acid, 95%, 4-(Butane-1-sulfonyl)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2,5g.
4-butylsulfonylbenzoic acid (CAS 100059-51-6) is a chemical compound with the molecular formula C11H14O4S and a molecular weight of 242.29 g/mol. IUPAC name: 4-butylsulfonylbenzoic acid. InChIKey: ZBKOZGCANJUKEY-UHFFFAOYSA-N.
| Molecular formula | C11H14O4S |
|---|---|
| Molecular weight | 242.29 g/mol |
| IUPAC name | 4-butylsulfonylbenzoic acid |
| InChIKey | ZBKOZGCANJUKEY-UHFFFAOYSA-N |
| SMILES | CCCCS(=O)(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)