Products 1105193-73-4
CAS 1105193-73-4 appears in our catalog under these names: 2-(4-(Propane-2-sulfonyl)phenyl)acetic acid, 2-[4-(Propane-2-sulfonyl)phenyl]acetic acid, 95%, 2-(4-(Propane-2-sulfonyl)phenyl)acetic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 500mg, 250mg, 1000mg, 2000mg, 5000mg, 10g, 1g, 5g.
2-(4-propan-2-ylsulfonylphenyl)acetic acid (CAS 1105193-73-4) is a chemical compound with the molecular formula C11H14O4S and a molecular weight of 242.29 g/mol. IUPAC name: 2-(4-propan-2-ylsulfonylphenyl)acetic acid. InChIKey: DNYIDVSDKGJLEJ-UHFFFAOYSA-N.
| Molecular formula | C11H14O4S |
|---|---|
| Molecular weight | 242.29 g/mol |
| IUPAC name | 2-(4-propan-2-ylsulfonylphenyl)acetic acid |
| InChIKey | DNYIDVSDKGJLEJ-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)C1=CC=C(C=C1)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-[4-(propane-2-sulfonyl)phenyl]acetic acid, 2-(4-(propane-2-sulfonyl)phenyl)acetic acid, [4-(Isopropylsulfonyl)phenyl]acetic acid, 2-(4-propan-2-ylsulfonylphenyl)acetic acid, [p-(isopropylsulfonyl)phenyl]acetic acid, 2-(4-isopropylsulfonylphenyl)acetic acid, 2-[4-(propane-2-sulfonyl)phenyl]aceticacid