Products 1183385-39-8

CAS 1183385-39-8 is the registry number for 4-(Propane-2-sulfonylmethyl)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-(propan-2-ylsulfonylmethyl)benzoic acid (CAS 1183385-39-8) is a chemical compound with the molecular formula C11H14O4S and a molecular weight of 242.29 g/mol. IUPAC name: 4-(propan-2-ylsulfonylmethyl)benzoic acid. InChIKey: VJAGENDKVAXWLY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O4S
Molecular weight242.29 g/mol
IUPAC name4-(propan-2-ylsulfonylmethyl)benzoic acid
InChIKeyVJAGENDKVAXWLY-UHFFFAOYSA-N
SMILESCC(C)S(=O)(=O)CC1=CC=C(C=C1)C(=O)O

Computed by PubChem (NCBI)