cas: 436867-71-9 — see every product listed under this CAS number, including other names
3-((tert-Butoxycarbonyl)amino)piperidine-3-carboxylic acid 95% (CAS 436867-71-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A459004-100mg |
| cas | 436867-71-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 731.94 Pln | |
| Ambeed | 1g | 1738.75 Pln | |
| Ambeed | 5g | 6361.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A459004 |
3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylic acid (CAS 436867-71-9) is a chemical compound with the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylic acid. InChIKey: ZCUAYUYDQUTSDE-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O4 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylic acid |
| InChIKey | ZCUAYUYDQUTSDE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCCNC1)C(=O)O |
Computed by PubChem (NCBI)