cas: 145625-08-7 — see every product listed under this CAS number, including other names
3-(1,1-Dimethylethyl) 4-methyl (2R,4S)-2-(1,1-dimethylethyl)-3,4-oxazolidinedicarboxylate, 95%, 95% (CAS 145625-08-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112D94-250mg |
| cas | 145625-08-7 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 568.40 Pln | |
| Chemat | 5g | 1902.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-O-tert-butyl 4-O-methyl (2R,4S)-2-tert-butyl-1,3-oxazolidine-3,4-dicarboxylate (CAS 145625-08-7) is a chemical compound with the molecular formula C14H25NO5 and a molecular weight of 287.35 g/mol. IUPAC name: 3-O-tert-butyl 4-O-methyl (2R,4S)-2-tert-butyl-1,3-oxazolidine-3,4-dicarboxylate. InChIKey: GZAZHWGEIRAXKK-GXSJLCMTSA-N.
| Molecular formula | C14H25NO5 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | 3-O-tert-butyl 4-O-methyl (2R,4S)-2-tert-butyl-1,3-oxazolidine-3,4-dicarboxylate |
| InChIKey | GZAZHWGEIRAXKK-GXSJLCMTSA-N |
| SMILES | CC(C)(C)[C@@H]1N([C@@H](CO1)C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)