cas: 1269087-62-8 — see every product listed under this CAS number, including other names
3-(1,3,5-Trimethyl-1H-pyrazol-4-yl)propanoic acid hydrochloride, 98%, 98% (CAS 1269087-62-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11J21D-100mg |
| cas | 1269087-62-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 515.60 Pln | |
| Chemat | 5g | 1422.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid;hydrochloride (CAS 1269087-62-8) is a chemical compound with the molecular formula C9H15ClN2O2 and a molecular weight of 218.68 g/mol. IUPAC name: 3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid;hydrochloride. InChIKey: AWHFHCCPTUJTMO-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN2O2 |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | 3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid;hydrochloride |
| InChIKey | AWHFHCCPTUJTMO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C)CCC(=O)O.Cl |
Computed by PubChem (NCBI)