cas: 63845-33-0 — see every product listed under this CAS number, including other names
3-(1-((Benzyloxy)carbonyl)piperidin-4-yl)propanoic acid, 95% (CAS 63845-33-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A177627-10g |
| cas | 63845-33-0 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 5147.80 Pln | |
| AmBeed | 250mg | 408.52 Pln | |
| AmBeed | 5g | 3116.68 Pln | |
| AmBeed | 25g | 10225.60 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(1-phenylmethoxycarbonylpiperidin-4-yl)propanoic acid (CAS 63845-33-0) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: 3-(1-phenylmethoxycarbonylpiperidin-4-yl)propanoic acid. InChIKey: NZTJJLCAFTZAGK-UHFFFAOYSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | 3-(1-phenylmethoxycarbonylpiperidin-4-yl)propanoic acid |
| InChIKey | NZTJJLCAFTZAGK-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CCC(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)