cas: 3569-21-9 — see every product listed under this CAS number, including other names
3-(1H-Indol-3-yl)propan-1-ol, 96%, 96% (CAS 3569-21-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HZD-100mg |
| cas | 3569-21-9 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 659.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
3-(1H-indol-3-yl)propan-1-ol (CAS 3569-21-9) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 3-(1H-indol-3-yl)propan-1-ol. InChIKey: LYPSVQXMCZIRGP-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 3-(1H-indol-3-yl)propan-1-ol |
| InChIKey | LYPSVQXMCZIRGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCCO |
Computed by PubChem (NCBI)