Products 3569-21-9
CAS 3569-21-9 appears in our catalog under these names: 1H-Indole-3-propanol, 95%, 3–Indolepropanol, Indole-3-propanol, 3-Indolepropanol, >98.0%(GC), Indole-3-propanol 95%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 5g, 1g, 2g, 10g, 25g, 250mg, 100mg.
3-(1H-indol-3-yl)propan-1-ol (CAS 3569-21-9) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 3-(1H-indol-3-yl)propan-1-ol. InChIKey: LYPSVQXMCZIRGP-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 3-(1H-indol-3-yl)propan-1-ol |
| InChIKey | LYPSVQXMCZIRGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCCO |
Computed by PubChem (NCBI)