cas: 3569-21-9 — see every product listed under this CAS number, including other names
Indole-3-propanol 95% (CAS 3569-21-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A510010-250mg |
| cas | 3569-21-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1193.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A510010 |
3-(1H-indol-3-yl)propan-1-ol (CAS 3569-21-9) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 3-(1H-indol-3-yl)propan-1-ol. InChIKey: LYPSVQXMCZIRGP-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 3-(1H-indol-3-yl)propan-1-ol |
| InChIKey | LYPSVQXMCZIRGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCCO |
Computed by PubChem (NCBI)