cas: 192717-19-4 — see every product listed under this CAS number, including other names
3-(1H-Indol-5-yl)propanoic acid, 97% (CAS 192717-19-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F626469-50MG |
| cas | 192717-19-4 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 362.39 Pln | |
| Fluorochem | 100mg | 513.38 Pln | |
| Fluorochem | 250mg | 862.21 Pln | |
| Fluorochem | 500mg | 1674.43 Pln | |
| Fluorochem | 1g | 2163.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-(1H-indol-5-yl)propanoic acid (CAS 192717-19-4) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 3-(1H-indol-5-yl)propanoic acid. InChIKey: QLLLZURKPNGXFF-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 3-(1H-indol-5-yl)propanoic acid |
| InChIKey | QLLLZURKPNGXFF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN2)C=C1CCC(=O)O |
Computed by PubChem (NCBI)