cas: 1831152-32-9 — see every product listed under this CAS number, including other names
3-(1H-PYRROL-1-YL)PHENYLBORONIC ACID PINACOL ESTER, 98% (CAS 1831152-32-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F817533-5G |
| cas | 1831152-32-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 9494.59 Pln | |
| Fluorochem | 100mg | 685.19 Pln | |
| Fluorochem | 250mg | 976.76 Pln | |
| Fluorochem | 1g | 2408.54 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrole (CAS 1831152-32-9) is a chemical compound with the molecular formula C16H20BNO2 and a molecular weight of 269.1 g/mol. IUPAC name: 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrole. InChIKey: XLPMAGPPJYOVHQ-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO2 |
|---|---|
| Molecular weight | 269.1 g/mol |
| IUPAC name | 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrole |
| InChIKey | XLPMAGPPJYOVHQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)N3C=CC=C3 |
Computed by PubChem (NCBI)