cas: 230295-12-2 — see every product listed under this CAS number, including other names
3-(2,3,6-Trifluorophenyl)acrylic acid 95% (E) (CAS 230295-12-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A330152-100mg |
| cas | 230295-12-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 698.56 Pln |
| purity | 95% (E) |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A330152 |
(E)-3-(2,3,6-trifluorophenyl)prop-2-enoic acid (CAS 230295-12-2) is a chemical compound with the molecular formula C9H5F3O2 and a molecular weight of 202.13 g/mol. IUPAC name: (E)-3-(2,3,6-trifluorophenyl)prop-2-enoic acid. InChIKey: OLYDUMMUGMYVHJ-DAFODLJHSA-N.
| Molecular formula | C9H5F3O2 |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | (E)-3-(2,3,6-trifluorophenyl)prop-2-enoic acid |
| InChIKey | OLYDUMMUGMYVHJ-DAFODLJHSA-N |
| SMILES | C1=CC(=C(C(=C1F)/C=C/C(=O)O)F)F |
Computed by PubChem (NCBI)