cas: 1956386-37-0 — see every product listed under this CAS number, including other names
3-(2,3-Dichlorophenyl)pyrrolidine hydrochloride, 95%, 95% (CAS 1956386-37-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I4J0-250mg |
| cas | 1956386-37-0 |
| size | 250mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1230.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(2,3-dichlorophenyl)pyrrolidine;hydrochloride (CAS 1956386-37-0) is a chemical compound with the molecular formula C10H12Cl3N and a molecular weight of 252.6 g/mol. IUPAC name: 3-(2,3-dichlorophenyl)pyrrolidine;hydrochloride. InChIKey: PSKGQFUQOPRQRU-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl3N |
|---|---|
| Molecular weight | 252.6 g/mol |
| IUPAC name | 3-(2,3-dichlorophenyl)pyrrolidine;hydrochloride |
| InChIKey | PSKGQFUQOPRQRU-UHFFFAOYSA-N |
| SMILES | C1CNCC1C2=C(C(=CC=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)