CAS 1158762-35-6 appears in our catalog under these names: N-[(2,6-Dichlorophenyl)methyl]cyclopropanamine hydrochloride, 95%, N-((2,6-Dichlorophenyl)methyl)cyclopropanamine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 2,5g.
N-[(2,6-dichlorophenyl)methyl]cyclopropanamine;hydrochloride (CAS 1158762-35-6) is a chemical compound with the molecular formula C10H12Cl3N and a molecular weight of 252.6 g/mol. IUPAC name: N-[(2,6-dichlorophenyl)methyl]cyclopropanamine;hydrochloride. InChIKey: UUGVHEUTHNJGNR-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl3N |
|---|---|
| Molecular weight | 252.6 g/mol |
| IUPAC name | N-[(2,6-dichlorophenyl)methyl]cyclopropanamine;hydrochloride |
| InChIKey | UUGVHEUTHNJGNR-UHFFFAOYSA-N |
| SMILES | C1CC1NCC2=C(C=CC=C2Cl)Cl.Cl |
Computed by PubChem (NCBI)