CAS 1199782-94-9 is the registry number for 5,7-Dichloro-1,2,3,4-tetrahydro-naphthalen-1-ylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.
5,7-dichloro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 1199782-94-9) is a chemical compound with the molecular formula C10H12Cl3N and a molecular weight of 252.6 g/mol. IUPAC name: 5,7-dichloro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: BZDCLULVGFYOCY-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl3N |
|---|---|
| Molecular weight | 252.6 g/mol |
| IUPAC name | 5,7-dichloro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | BZDCLULVGFYOCY-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C(=CC(=C2)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)