CAS 1384269-00-4 is the registry number for (R)-3-(3,4-Dichlorophenyl)pyrrolidine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3R)-3-(3,4-dichlorophenyl)pyrrolidine;hydrochloride (CAS 1384269-00-4) is a chemical compound with the molecular formula C10H12Cl3N and a molecular weight of 252.6 g/mol. IUPAC name: (3R)-3-(3,4-dichlorophenyl)pyrrolidine;hydrochloride. InChIKey: CLEBEYWTFWLKQX-QRPNPIFTSA-N.
| Molecular formula | C10H12Cl3N |
|---|---|
| Molecular weight | 252.6 g/mol |
| IUPAC name | (3R)-3-(3,4-dichlorophenyl)pyrrolidine;hydrochloride |
| InChIKey | CLEBEYWTFWLKQX-QRPNPIFTSA-N |
| SMILES | C1CNC[C@H]1C2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)