cas: 13063-09-7 — see every product listed under this CAS number, including other names
3-(2,4,6-Trimethoxyphenyl)acrylic acid, 97%(HPLC),RG, 97%(HPLC),RG (CAS 13063-09-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111UQ0-250mg |
| cas | 13063-09-7 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 568.40 Pln | |
| Chemat | 5g | 1922.00 Pln |
| purity | 97%(HPLC),RG |
|---|---|
| delivery time | 3 weeks |
(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoic acid (CAS 13063-09-7) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: (E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoic acid. InChIKey: NCPKRIPFNFIXOK-SNAWJCMRSA-N.
| Molecular formula | C12H14O5 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | (E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoic acid |
| InChIKey | NCPKRIPFNFIXOK-SNAWJCMRSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)/C=C/C(=O)O)OC |
Computed by PubChem (NCBI)