cas: 40017-76-3 — see every product listed under this CAS number, including other names
3-(2,6-Difluorophenyl)-3-oxopropanenitrile, 97% (CAS 40017-76-3) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F239212-500MG |
| cas | 40017-76-3 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 971.55 Pln | |
| Fluorochem | 1g | 1502.61 Pln | |
| Fluorochem | 5g | 4845.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-(2,6-difluorophenyl)-3-oxopropanenitrile (CAS 40017-76-3) is a chemical compound with the molecular formula C9H5F2NO and a molecular weight of 181.14 g/mol. IUPAC name: 3-(2,6-difluorophenyl)-3-oxopropanenitrile. InChIKey: UFGUAZITUTVDOC-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO |
|---|---|
| Molecular weight | 181.14 g/mol |
| IUPAC name | 3-(2,6-difluorophenyl)-3-oxopropanenitrile |
| InChIKey | UFGUAZITUTVDOC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)CC#N)F |
Computed by PubChem (NCBI)