Products 1261861-12-4

CAS 1261861-12-4 is the registry number for 3-(2-Bromo-6-methylphenyl)propanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

3-(2-bromo-6-methylphenyl)propanoic acid (CAS 1261861-12-4) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 3-(2-bromo-6-methylphenyl)propanoic acid. InChIKey: DDGLXWBHCAYDMC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BrO2
Molecular weight243.10 g/mol
IUPAC name3-(2-bromo-6-methylphenyl)propanoic acid
InChIKeyDDGLXWBHCAYDMC-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)Br)CCC(=O)O

Computed by PubChem (NCBI)