3-(2-Bromo-6-methylphenyl)propanoic acid, 95%
cas: 1261861-12-4 — see every product listed under this CAS number, including other names
3-(2-Bromo-6-methylphenyl)propanoic acid, 95% (CAS 1261861-12-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1042206-250mg |
| cas | 1261861-12-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1521.81 Pln | |
| Ambeed | 1g | 4047.19 Pln | |
| Chemat | 50mg | 688.40 Pln | |
| Chemat | 100mg | 1048.40 Pln | |
| Chemat | 250mg | 1706.00 Pln | |
| BLDpharm | 50mg | 675.34 Pln | |
| BLDpharm | 100mg | 1036.33 Pln | |
| BLDpharm | 250mg | 1636.12 Pln | |
| BLDpharm | 1g | 4362.93 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-(2-bromo-6-methylphenyl)propanoic acid (CAS 1261861-12-4) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 3-(2-bromo-6-methylphenyl)propanoic acid. InChIKey: DDGLXWBHCAYDMC-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 3-(2-bromo-6-methylphenyl)propanoic acid |
| InChIKey | DDGLXWBHCAYDMC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Br)CCC(=O)O |
Computed by PubChem (NCBI)