cas: 5246-57-1 — see every product listed under this CAS number, including other names
3-(2-Hydroxyethylsulfonyl)aniline (CAS 5246-57-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 200mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0DV-1g |
| cas | 5246-57-1 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 208.40 Pln | |
| Chemat | 200mg | 131.60 Pln | |
| Chemat | 5g | 746.00 Pln |
| delivery time | 3 weeks |
|---|
2-(3-aminophenyl)sulfonylethanol (CAS 5246-57-1) is a chemical compound with the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. IUPAC name: 2-(3-aminophenyl)sulfonylethanol. InChIKey: ASASRSMRAPYLQI-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 2-(3-aminophenyl)sulfonylethanol |
| InChIKey | ASASRSMRAPYLQI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)CCO)N |
Computed by PubChem (NCBI)