cas: 1052526-99-4 — see every product listed under this CAS number, including other names
3-(2-Isopropyl-1H-imidazol-1-yl)propanoic acid hydrochloride, 97%, 97% (CAS 1052526-99-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AI11-100mg |
| cas | 1052526-99-4 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 299.60 Pln | |
| Chemat | 5g | 770.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(2-propan-2-ylimidazol-1-yl)propanoic acid;hydrochloride (CAS 1052526-99-4) is a chemical compound with the molecular formula C9H15ClN2O2 and a molecular weight of 218.68 g/mol. IUPAC name: 3-(2-propan-2-ylimidazol-1-yl)propanoic acid;hydrochloride. InChIKey: IBXROQZOCMEXLE-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN2O2 |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | 3-(2-propan-2-ylimidazol-1-yl)propanoic acid;hydrochloride |
| InChIKey | IBXROQZOCMEXLE-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC=CN1CCC(=O)O.Cl |
Computed by PubChem (NCBI)