cas: 1156068-41-5 — see every product listed under this CAS number, including other names
3-(2-methoxy-5-nitrophenoxy)propan-1-ol (CAS 1156068-41-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DDU4-1g |
| cas | 1156068-41-5 |
| size | 1g |
| availability | 20.28g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 7134.80 Pln |
| delivery time | 3 weeks |
|---|
3-(2-methoxy-5-nitrophenoxy)propan-1-ol (CAS 1156068-41-5) is a chemical compound with the molecular formula C10H13NO5 and a molecular weight of 227.21 g/mol. IUPAC name: 3-(2-methoxy-5-nitrophenoxy)propan-1-ol. InChIKey: IAKZNHJZKXNJNU-UHFFFAOYSA-N.
| Molecular formula | C10H13NO5 |
|---|---|
| Molecular weight | 227.21 g/mol |
| IUPAC name | 3-(2-methoxy-5-nitrophenoxy)propan-1-ol |
| InChIKey | IAKZNHJZKXNJNU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])OCCCO |
Computed by PubChem (NCBI)