Products 1414864-16-6

CAS 1414864-16-6 is the registry number for Methyl 2,5,6-trimethoxynicotinate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2,5,6-trimethoxypyridine-3-carboxylate (CAS 1414864-16-6) is a chemical compound with the molecular formula C10H13NO5 and a molecular weight of 227.21 g/mol. IUPAC name: methyl 2,5,6-trimethoxypyridine-3-carboxylate. InChIKey: ZAWUMIQBYANWHM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO5
Molecular weight227.21 g/mol
IUPAC namemethyl 2,5,6-trimethoxypyridine-3-carboxylate
InChIKeyZAWUMIQBYANWHM-UHFFFAOYSA-N
SMILESCOC1=C(N=C(C(=C1)C(=O)OC)OC)OC

Computed by PubChem (NCBI)