CAS 1156068-41-5 appears in our catalog under these names: 3-(2-Methoxy-5-nitrophenoxy)propan-1-ol, 95%, Bosutinib Impurity 18, 3-(2-methoxy-5-nitrophenoxy)propan-1-ol. Offered by: Combi-blocks, Chemat Brand, Chemat. Available pack sizes: 1g, 100mg, 250mg, on request.
3-(2-methoxy-5-nitrophenoxy)propan-1-ol (CAS 1156068-41-5) is a chemical compound with the molecular formula C10H13NO5 and a molecular weight of 227.21 g/mol. IUPAC name: 3-(2-methoxy-5-nitrophenoxy)propan-1-ol. InChIKey: IAKZNHJZKXNJNU-UHFFFAOYSA-N.
| Molecular formula | C10H13NO5 |
|---|---|
| Molecular weight | 227.21 g/mol |
| IUPAC name | 3-(2-methoxy-5-nitrophenoxy)propan-1-ol |
| InChIKey | IAKZNHJZKXNJNU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])OCCCO |
Computed by PubChem (NCBI)