CAS 529474-73-5 is the registry number for 2-((1R,2S)-3-Ethoxy-1,2-dihydroxy-3-oxopropyl)pyridine 1-oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2S,3R)-2,3-dihydroxy-3-(1-oxidopyridin-1-ium-2-yl)propanoate (CAS 529474-73-5) is a chemical compound with the molecular formula C10H13NO5 and a molecular weight of 227.21 g/mol. IUPAC name: ethyl (2S,3R)-2,3-dihydroxy-3-(1-oxidopyridin-1-ium-2-yl)propanoate. InChIKey: QPEVIMSXVHVXOC-BDAKNGLRSA-N.
| Molecular formula | C10H13NO5 |
|---|---|
| Molecular weight | 227.21 g/mol |
| IUPAC name | ethyl (2S,3R)-2,3-dihydroxy-3-(1-oxidopyridin-1-ium-2-yl)propanoate |
| InChIKey | QPEVIMSXVHVXOC-BDAKNGLRSA-N |
| SMILES | CCOC(=O)[C@H]([C@@H](C1=CC=CC=[N+]1[O-])O)O |
Computed by PubChem (NCBI)