cas: 550364-01-7 — see every product listed under this CAS number, including other names
3-(2H-1,2,3-Triazol-4-yl)benzonitrile, 98% (CAS 550364-01-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A422833-5g |
| cas | 550364-01-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7178.92 Pln | |
| Fluorochem | 250mg | 502.97 Pln | |
| Fluorochem | 1g | 1096.51 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(2H-triazol-4-yl)benzonitrile (CAS 550364-01-7) is a chemical compound with the molecular formula C9H6N4 and a molecular weight of 170.17 g/mol. IUPAC name: 3-(2H-triazol-4-yl)benzonitrile. InChIKey: WTEOJKCYXGSBQC-UHFFFAOYSA-N.
| Molecular formula | C9H6N4 |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | 3-(2H-triazol-4-yl)benzonitrile |
| InChIKey | WTEOJKCYXGSBQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=NNN=C2)C#N |
Computed by PubChem (NCBI)