CAS 15935-95-2 is the registry number for 2-Amino-[1,8]naphthyridine-3-carbonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-amino-1,8-naphthyridine-3-carbonitrile (CAS 15935-95-2) is a chemical compound with the molecular formula C9H6N4 and a molecular weight of 170.17 g/mol. IUPAC name: 2-amino-1,8-naphthyridine-3-carbonitrile. InChIKey: OAKUSQCSHYQNHJ-UHFFFAOYSA-N.
| Molecular formula | C9H6N4 |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | 2-amino-1,8-naphthyridine-3-carbonitrile |
| InChIKey | OAKUSQCSHYQNHJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(N=C2N=C1)N)C#N |
Computed by PubChem (NCBI)