Products 25699-88-1
CAS 25699-88-1 appears in our catalog under these names: 3-(1,2,4-Triazol-1-yl)benzonitrile, 97%, 3-(1H-1,2,4-Triazol-1-yl)benzonitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 10g, 5g, 1g, 25g.
3-(1,2,4-triazol-1-yl)benzonitrile (CAS 25699-88-1) is a chemical compound with the molecular formula C9H6N4 and a molecular weight of 170.17 g/mol. IUPAC name: 3-(1,2,4-triazol-1-yl)benzonitrile. InChIKey: ARARITHHDLOSQH-UHFFFAOYSA-N.
| Molecular formula | C9H6N4 |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | 3-(1,2,4-triazol-1-yl)benzonitrile |
| InChIKey | ARARITHHDLOSQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C=NC=N2)C#N |
Computed by PubChem (NCBI)