CAS 1152822-31-5 appears in our catalog under these names: 2-(Pyrazol-1-yl)-3-cyanopyridine, 98%, 2-(Pyrazol-1-yl)-3-cyanopyridine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 100g, 5g, 25g, 1g.
2-pyrazol-1-ylpyridine-3-carbonitrile (CAS 1152822-31-5) is a chemical compound with the molecular formula C9H6N4 and a molecular weight of 170.17 g/mol. IUPAC name: 2-pyrazol-1-ylpyridine-3-carbonitrile. InChIKey: TXYIYGOHWGLULK-UHFFFAOYSA-N.
| Molecular formula | C9H6N4 |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | 2-pyrazol-1-ylpyridine-3-carbonitrile |
| InChIKey | TXYIYGOHWGLULK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)N2C=CC=N2)C#N |
Computed by PubChem (NCBI)