cas: 379726-46-2 — see every product listed under this CAS number, including other names
3-(3-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-phenyl-1H-pyrazol-4-yl)prop-2-enoic acid, 95% (CAS 379726-46-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1006936-5g |
| cas | 379726-46-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10733.38 Pln | |
| AmBeed | 10g | 16065.07 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
(E)-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]prop-2-enoic acid (CAS 379726-46-2) is a chemical compound with the molecular formula C20H16N2O4 and a molecular weight of 348.4 g/mol. IUPAC name: (E)-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]prop-2-enoic acid. InChIKey: ZOTORXKWXDPWNJ-VQHVLOKHSA-N.
| Molecular formula | C20H16N2O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | (E)-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]prop-2-enoic acid |
| InChIKey | ZOTORXKWXDPWNJ-VQHVLOKHSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C3=NN(C=C3/C=C/C(=O)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)